CAS 51166-72-4
:2A,2B,2C,2D,2E,2F,6A,6B,6C,6D,6E,6F-Dodeca-O-methyl-α-cyclodextrin
Description:
2A,2B,2C,2D,2E,2F,6A,6B,6C,6D,6E,6F-Dodeca-O-methyl-α-cyclodextrin is a modified form of α-cyclodextrin, which is a cyclic oligosaccharide composed of six glucose units. This compound features multiple methoxy groups (-OCH3) attached to its hydroxyl positions, enhancing its solubility and stability in various solvents. The introduction of these methyl groups alters the hydrophilic-lipophilic balance, allowing for improved encapsulation properties, making it useful in drug delivery systems and food applications. Its unique structure enables it to form inclusion complexes with a variety of guest molecules, which can enhance the bioavailability of poorly soluble compounds. Additionally, this compound exhibits low toxicity and is generally recognized as safe (GRAS) for use in food and pharmaceutical applications. Its ability to form stable complexes and improve the solubility of active ingredients makes it a valuable excipient in various formulations. Overall, 2A,2B,2C,2D,2E,2F,6A,6B,6C,6D,6E,6F-Dodeca-O-methyl-α-cyclodextrin is a versatile compound with significant potential in multiple industries.
Formula:C48H84O30
InChI:InChI=1S/C48H84O30/c1-55-13-19-31-25(49)37(61-7)43(67-19)74-32-20(14-56-2)69-45(39(63-9)26(32)50)76-34-22(16-58-4)71-47(41(65-11)28(34)52)78-36-24(18-60-6)72-48(42(66-12)30(36)54)77-35-23(17-59-5)70-46(40(64-10)29(35)53)75-33-21(15-57-3)68-44(73-31)38(62-8)27(33)51/h19-54H,13-18H2,1-12H3/t19-,20-,21-,22-,23-,24-,25+,26+,27+,28+,29+,30+,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48-/m1/s1
InChI key:InChIKey=GTXJHJOCVPTNTP-MLJFYOOPSA-N
SMILES:C(OC)[C@@H]1[C@@]2([C@H](O)[C@@H](OC)[C@](O1)(O[C@@]3([C@@H](COC)O[C@@]([C@H](OC)[C@H]3O)(O[C@@]4([C@@H](COC)O[C@@]([C@H](OC)[C@H]4O)(O[C@]5([C@H](O)[C@@H](OC)[C@@](O[C@]6([C@H](O)[C@@H](OC)[C@@](O[C@]7([C@H](O)[C@@H](OC)[C@@](O2)(O[C@@H]7COC)[H])[H])(O[C@@H]6COC)[H])[H])(O[C@@H]5COC)[H])[H])[H])[H])[H])[H])[H])[H]
Synonyms:- 2,4,7,9,12,14,17,19,22,24,27,29-Dodecaoxaheptacyclo[26.2.2.23,6.28,11.213,16.218,21.223,26]dotetracontane, α-cyclodextrin deriv.
- 2A,2B,2C,2D,2E,2F,6A,6B,6C,6D,6E,6F-Dodeca-O-methyl-α-cyclodextrin
- Dodecakis-2,6-O-methylcyclohexaamylose
- Hexakis(2,6-O-dimethyl)-α-cyclodextrin
- α-Cyclodextrin, 2A,2B,2C,2D,2E,2F,6A,6B,6C,6D,6E,6F-dodeca-O-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,6-Dimethyl-a-cyclodextrin >70%
CAS:<p>Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.</p>Formula:C48H84O30Purity:Min. 95%Color and Shape:PowderMolecular weight:1,141.16 g/mol
