CAS 5117-55-5

(2Z)-2-[hydroxy(methoxy)methylidene]-1-benzofuran-3(2H)-one

Description:

The chemical substance known as (2Z)-2-[hydroxy(methoxy)methylidene]-1-benzofuran-3(2H)-one, with the CAS number 5117-55-5, is a benzofuran derivative characterized by its unique structural features. This compound contains a benzofuran core, which is a fused bicyclic structure comprising a benzene ring and a furan ring. The presence of a hydroxy group and a methoxy group attached to a methylene bridge contributes to its reactivity and potential biological activity. The (2Z) configuration indicates a specific geometric arrangement around the double bond, which can influence the compound's properties and interactions. This substance may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound represents a class of organic molecules that may have applications in drug development and other fields of chemistry.

Formula: C₁₀H₈O₄

InChI: InChI=1/C10H8O4/c1-13-10(12)9-8(11)6-4-2-3-5-7(6)14-9/h2-5,12H,1H3/b10-9-

InChI key: HOWXDNGXHMYIIK-UHFFFAOYSA-N

SMILES: COC(=O)C1=C(C2=CC=CC=C2O1)O