CymitQuimica logo

CAS 51186-58-4

:

Boc-D-aspartic acid 4-benzyl ester

Description:
Boc-D-aspartic acid 4-benzyl ester is a chemical compound that serves as a protected form of the amino acid aspartic acid, which is essential in various biochemical processes. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group used in peptide synthesis, providing stability and preventing unwanted reactions during the synthesis process. The presence of the 4-benzyl ester moiety enhances the lipophilicity of the molecule, which can influence its solubility and permeability in biological systems. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but less soluble in water. It is often utilized in the synthesis of peptides and other derivatives in medicinal chemistry and biochemistry. The compound's structure allows for selective reactions, making it valuable in the development of pharmaceuticals and research applications. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C16H21NO6
InChI:InChI=1S/C16H21NO6/c1-16(2,3)23-15(21)17-12(14(19)20)9-13(18)22-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,17,21)(H,19,20)/t12-/m1/s1
InChI key:SOHLZANWVLCPHK-GFCCVEGCSA-N
SMILES:CC(C)(C)OC(=O)N[C@H](CC(=O)OCC1=CC=CC=C1)C(=O)O
Synonyms:
  • Boc-D-Asp(OBzl)-OH
  • Boc-DL-Asp(OBzl)-OH
Found 6 products.