CAS 51195-71-2
:1,2-Distearoyl-3-oleoyl-rac-glycerol
Description:
1,2-Distearoyl-3-oleoyl-rac-glycerol, commonly referred to as a type of glycerolipid, is a triacylglycerol that features two stearic acid (C18:0) chains and one oleic acid (C18:1) chain esterified to a glycerol backbone. This compound is characterized by its hydrophobic nature due to the long fatty acid chains, which contribute to its role in forming lipid bilayers and membranes. It is typically solid at room temperature due to the presence of saturated fatty acids, while the unsaturated oleic acid introduces some fluidity. This glycerolipid is often utilized in food, pharmaceutical, and cosmetic formulations as an emulsifier or stabilizer, enhancing texture and consistency. Additionally, it can serve as a model compound in studies of lipid metabolism and membrane dynamics. Its properties, such as melting point and solubility, can vary based on the specific conditions and the presence of other components in a formulation. Overall, 1,2-Distearoyl-3-oleoyl-rac-glycerol plays a significant role in various biochemical and industrial applications.
Formula:C57H108O6
InChI:InChI=1/C57H108O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25,28,54H,4-24,26-27,29-53H2,1-3H3/b28-25-
InChI key:InChIKey=YFFIQXNTTVSKJC-FVDSYPCUNA-N
SMILES:C(OC(CCCCCCCCCCCCCCCCC)=O)(COC(CCCCCCCCCCCCCCCCC)=O)COC(CCCCCCC/C=C\CCCCCCCC)=O
Synonyms:- (±)-Glycerol 1,2-distearate 3-oleate
- 1,2-Distearo-3-olein
- 1-Oleo-2,3-distearin
- 1-Oleoyl distearin
- 2,3-bis(octadecanoyloxy)propyl (9E)-octadec-9-enoate
- 3-Oleo-1,2-distearin
- 9-Octadecenoic acid (9Z)-, 2,3-bis[(1-oxooctadecyl)oxy]propyl ester
- 9-Octadecenoic acid (Z)-, 2,3-bis[(1-oxooctadecyl)oxy]propyl ester
- Glyceryl 1-oleate-2,3-distearate
- Olein, 2,3-distearo-1-
- Stearin, 3-oleo-1,2-di-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2-Distearoyl-3-oleoyl-rac-glycerol-d5
CAS:Controlled ProductApplications 1,2-Distearoyl-3-oleoyl-rac-glycerol-d5 is labelled 1,2-Distearoyl-3-oleoyl-rac-glycerol (D493520) which is used in the study of leptin resistance at the blood-brain barrier.
References Banks, W., et al.: Diabetes, 53, 1253 (2004);Formula:C57D5H103O6Color and Shape:NeatMolecular weight:894.495
