CAS 512-64-1
:echinomycin
Description:
Echinomycin, with the CAS number 512-64-1, is a naturally occurring antibiotic that belongs to the class of compounds known as cyclic peptides. It is primarily derived from the bacterium *Streptomyces echinatus*. Echinomycin exhibits a unique structure characterized by a cyclic arrangement of amino acids, which contributes to its biological activity. This compound is known for its ability to intercalate into DNA, thereby inhibiting the transcription of RNA and affecting protein synthesis. Echinomycin has demonstrated antitumor properties, making it of interest in cancer research and potential therapeutic applications. It is typically soluble in organic solvents but has limited solubility in water. The compound's mechanism of action involves binding to specific DNA sequences, which can lead to the disruption of cellular processes in rapidly dividing cells. Due to its potent biological effects, echinomycin is studied for its potential use in chemotherapy, although its clinical application is limited by toxicity and side effects. Overall, echinomycin represents a significant area of interest in medicinal chemistry and pharmacology.
Formula:C8H10O
InChI:InChI=1/C8H10O/c1-2-7-5-3-4-6-8(7)9/h3-6,9H,2H2,1H3
SMILES:CCc1ccccc1O
Synonyms:- Brn 0078671
- Nsc 526417
- Quinomycin A
- S-426-S (Lepetit)
- Sk 302B
- Stereoisomer of N,N'-(2,4,12,15,17,25-hexamethyl-11,24-bis(1-methylethyl)-27-(methylthio)-3,6,10,13,16,19,23,26-octaoxo-9,22-dioxa-28-thia-2,5,12,15,18,25-hexaazabicyclo(12.12.3)nonacosane-7,20-diyl)bis(2-quinoxalinecarboxamide)
- Quinomycin A (9CI)
- N,N'-[2,4,12,15,17,25-hexamethyl-27-(methylsulfanyl)-3,6,10,13,16,19,23,26-octaoxo-11,24-di(propan-2-yl)-9,22-dioxa-28-thia-2,5,12,15,18,25-hexaazabicyclo[12.12.3]nonacosane-7,20-diyl]diquinoxaline-2-carboxamide
- 4-27-00-09726 (Beilstein Handbook Reference)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Echinomycin, Quinomycin A
CAS:Formula:C51H64N12O12S2Purity:94.0%Color and Shape:Whitish. SolidMolecular weight:1100.0Echinomycin
CAS:Echinomycin (Quinomycin A) is a quinoxaline antibiotic and a DNA-intercalating peptide that inhibits hypoxia-inducible factor-1 (HIF-1) DNA binding activity.Formula:C51H64N12O12S2Purity:95%Color and Shape:SolidMolecular weight:1101.26Quinomycin A
CAS:Formula:C51H64N12O12S2Purity:≥ 98.0%Color and Shape:Off-white powderMolecular weight:1101.3




