
CAS 512-72-1: Ajugose
Description:Ajugose, with the CAS number 512-72-1, is a chemical compound classified as a triterpenoid saponin. It is primarily derived from the plant species Ajuga, which is known for its medicinal properties. Ajugose exhibits a complex structure characterized by a steroid-like backbone, which contributes to its biological activity. This compound is recognized for its potential pharmacological effects, including anti-inflammatory, antimicrobial, and cytotoxic properties. Ajugose is soluble in water and organic solvents, which enhances its bioavailability and interaction with biological systems. Its saponin nature allows it to form stable foams and emulsions, making it of interest in both pharmaceutical and cosmetic formulations. Additionally, ajugose may play a role in traditional herbal medicine, although further research is needed to fully elucidate its mechanisms of action and therapeutic potential. As with many natural products, the extraction and purification processes can significantly influence its efficacy and safety profile.
Formula:C36H62O31
InChI:InChI=1S/C36H62O31/c37-1-8-14(40)20(46)25(51)31(61-8)57-3-10-15(41)21(47)26(52)32(62-10)58-4-11-16(42)22(48)27(53)33(63-11)59-5-12-17(43)23(49)28(54)34(64-12)60-6-13-18(44)24(50)29(55)35(65-13)67-36(7-39)30(56)19(45)9(2-38)66-36/h8-35,37-56H,1-7H2/t8-,9-,10-,11-,12-,13-,14+,15+,16+,17+,18-,19-,20+,21+,22+,23+,24+,25-,26-,27-,28-,29-,30+,31+,32+,33+,34+,35-,36+/m1/s1
InChI key:InChIKey=NCIHJQNXRKJRMJ-HKJJPIHFSA-N
SMILES:OCC1OC(OCC2OC(OCC3OC(OCC4OC(OCC5OC(OC6(OC(CO)C(O)C6O)CO)C(O)C(O)C5O)C(O)C(O)C4O)C(O)C(O)C3O)C(O)C(O)C2O)C(O)C(O)C1O
- Synonyms:
- β-D-Fructofuranosyl O-α-D-galactopyranosyl-(1→6)-O-α-D-galactopyranosyl-(1→6)-O-α-D-galactopyranosyl-(1→6)-O-α-D-galactopyranosyl-(1→6)-α-D-glucopyranoside
- Ajugose
- α-D-Glucopyranoside, β-D-fructofuranosyl O-α-D-galactopyranosyl-(1→6)-O-α-D-galactopyranosyl-(1→6)-O-α-D-galactopyranosyl-(1→6)-O-α-D-galactopyranosyl-(1→6)-
- D-Ajugose
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ajugose REF: BP-BP4955CAS: 512-72-1 | 95%~99% | 779.00 € | Tue 15 Apr 25 |