CAS 512177-83-2

(2R)-3-acetyl-1-(4-chloro-2-fluoro-phenyl)-2-cyclohexyl-4-hydroxy-2H-pyrrol-5-one

Description:

The chemical substance known as (2R)-3-acetyl-1-(4-chloro-2-fluoro-phenyl)-2-cyclohexyl-4-hydroxy-2H-pyrrol-5-one, with the CAS number 512177-83-2, is a pyrrole derivative characterized by its complex molecular structure. It features a pyrrolone core, which is a five-membered heterocyclic compound containing both nitrogen and a carbonyl group. The presence of an acetyl group and a hydroxy group contributes to its reactivity and potential biological activity. The substitution of a cyclohexyl group and a halogenated phenyl moiety (with both chlorine and fluorine atoms) indicates that this compound may exhibit unique electronic and steric properties, which could influence its interactions in biological systems. Such compounds are often investigated for their potential pharmacological applications, including anti-inflammatory or anticancer activities. The specific stereochemistry denoted by (2R) suggests that the compound has a defined spatial arrangement, which is crucial for its biological function and interaction with target molecules. Overall, this compound represents a class of organic molecules with potential significance in medicinal chemistry.

Formula: C₁₈H₁₉ClFNO₃

InChI: InChI=1/C18H19ClFNO3/c1-10(22)15-16(11-5-3-2-4-6-11)21(18(24)17(15)23)14-8-7-12(19)9-13(14)20/h7-9,11,16,23H,2-6H2,1H3/t16-/m1/s1

SMILES: CC(=O)C1=C(C(=O)N(c2ccc(cc2F)Cl)[C@@H]1C1CCCCC1)O

CCR2-RA-[R]

CAS: 512177-83-2

CCR2-RA-[R] is a C-C chemokine receptor type 2 (CCR2) allosteric antagonist (IC50: 103 nM).

Formula: C₁₈H₁₉ClFNO₃

Purity: 99.7%

Color and Shape: Solid

Molecular weight: 351.8

Ref: TM-T14900

2H-Pyrrol-2-one, 4-acetyl-1-(4-chloro-2-fluorophenyl)-5-cyclohexyl-1,5-dihydro-3-hydroxy-, (5R)-

CAS: 512177-83-2

Formula: C₁₈H₁₉ClFNO₃

Purity: 99%

Color and Shape: Solid

Molecular weight: 351.7998

Ref: IN-DA00DY59

CCR2-RA-[R]

CAS: 512177-83-2

CCR2-RA-[R]

Purity: ≥98%

Molecular weight: 351.8g/mol

Ref: 54-BUP09886

CCR2 RA-[R]

CAS: 512177-83-2

Chemokine receptor 2 (CCR2) antagonist

Formula: C₁₈H₁₉ClFNO₃

Purity: Min. 95%

Color and Shape: Off-White To Yellow Solid

Molecular weight: 351.8 g/mol

Ref: 3D-FA101897