CAS 51219-89-7

Urea, tetra(methyl-d3)-

Description:

Urea, tetra(methyl-d3)-, also known by its CAS number 51219-89-7, is a deuterated form of urea, where the hydrogen atoms in the methyl groups are replaced by deuterium, a stable isotope of hydrogen. This compound is characterized by its molecular formula, which reflects the presence of four methyl groups attached to the nitrogen atoms of the urea structure. As a deuterated compound, it is often used in various scientific applications, particularly in NMR spectroscopy, where the presence of deuterium can enhance the resolution and sensitivity of the analysis. Urea itself is a colorless, crystalline solid that is highly soluble in water and has a relatively high melting point. The tetra(methyl-d3)- variant retains these properties but is specifically utilized in research settings to study metabolic pathways, protein interactions, and other biochemical processes. Its unique isotopic labeling allows for precise tracking of molecular behavior in complex systems, making it a valuable tool in both organic and analytical chemistry.

Formula: C₅D₁₂N₂O

InChI: InChI=1S/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3/i1D3,2D3,3D3,4D3

InChI key: InChIKey=AVQQQNCBBIEMEU-MGKWXGLJSA-N

SMILES: C(N(C([2H])([2H])[2H])C([2H])([2H])[2H])(N(C([2H])([2H])[2H])C([2H])([2H])[2H])=O

Synonyms:

• Tetramethylurea-d12
• Urea, tetra(methyl-d3)-
• 1,1,3,3-Tetrakis(trideuteriomethyl)urea

Tetramethyl-d12-urea

CAS: 51219-89-7

Formula: (CD₃)₂NCON(CD₃)₂

Purity: 99 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 128.17028

Ref: 3U-D0574

Tetramethyl-d12-urea

Controlled Product

CAS: 51219-89-7

Applications Tetramethyl-d12-urea (CAS# 51219-89-7) is a useful isotopically labeled research compound.

Formula: C₅D₁₂N₂O

Color and Shape: Neat

Molecular weight: 128.24

Ref: TR-T305651