CAS 5122-20-3
:5-tert-butyl-2-iodo-1,3-dimethylbenzene
Description:
5-tert-butyl-2-iodo-1,3-dimethylbenzene, also known by its CAS number 5122-20-3, is an organic compound belonging to the class of iodo-substituted aromatic hydrocarbons. This compound features a benzene ring with multiple substituents: a tert-butyl group, two methyl groups, and an iodine atom. The presence of the iodine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The tert-butyl group contributes to steric hindrance, influencing the compound's reactivity and stability. The methyl groups provide additional electron-donating effects, which can affect the electronic properties of the aromatic system. This compound is typically used in organic synthesis and may serve as an intermediate in the production of more complex molecules. Its physical properties, such as boiling point and solubility, are influenced by the bulky tert-butyl group and the polar nature of the iodine substituent. Overall, 5-tert-butyl-2-iodo-1,3-dimethylbenzene is a valuable compound in synthetic organic chemistry.
Formula:C12H17I
InChI:InChI=1/C12H17I/c1-8-6-10(12(3,4)5)7-9(2)11(8)13/h6-7H,1-5H3
SMILES:Cc1cc(cc(C)c1I)C(C)(C)C
Synonyms:- Benzene, 5-(1,1-Dimethylethyl)-2-Iodo-1,3-Dimethyl-
- 5-(TERT-BUTYL)-2-IODO-1,3-DIMETHYLBENZENE
- 5-tert-Butyl-2-iodo-1,3-dimethylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-tert-Butyl-2-iodo-1,3-dimethylbenzene, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H17IPurity:97%Color and Shape:White to pale yellow, Crystals or powder or crystalline powderMolecular weight:288.175-(tert-Butyl)-2-iodo-1,3-dimethylbenzene
CAS:Formula:C12H17IPurity:97%Color and Shape:SolidMolecular weight:288.16785-tert-Butyl-2-iodo-1,3-dimethylbenzene
CAS:<p>5-tert-Butyl-2-iodo-1,3-dimethylbenzene</p>Formula:C12H17IPurity:≥95%Color and Shape:SolidMolecular weight:288.16784g/mol



