CAS 5122-94-1
:4-Biphenylboronic acid
Description:
4-Biphenylboronic acid, with the CAS number 5122-94-1, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a biphenyl structure. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents such as ethanol and methanol, but has limited solubility in water. It is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis, materials science, and as a reagent in Suzuki-Miyaura cross-coupling reactions. The boronic acid group allows for the formation of stable complexes with sugars and other biomolecules, which is useful in biochemical applications. Additionally, 4-biphenylboronic acid can serve as a building block in the synthesis of more complex organic molecules. Its chemical stability and reactivity under mild conditions make it a versatile compound in both academic research and industrial applications.
Formula:C12H11BO2
InChI:InChI=1/C12H11BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,14-15H
SMILES:c1ccc(cc1)c1ccc(cc1)B(O)O
Synonyms:- (1,1-Biphenyl-4-yl)boronic acid
- 4-Phenylbenzeneboronic acid
- [1,1-Biphenyl]-4-ylboronic acid
- Biphenyl-4-Ylboronic Acid
- Rarechem Ah Pb 0261
- 4-Diphenylboronicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Biphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C12H11BO2Purity:97.0 to 110.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:198.03Biphenyl-4-boronic acid, 97+%
CAS:Used in Suzuki reactions and as intermediates of liquid crystals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referen
Formula:C12H11BO2Purity:97+%Color and Shape:White to cream, PowderMolecular weight:198.03(1,1'-Biphenyl-4-yl)boronic acid
CAS:Formula:C12H11BO2Purity:98%Color and Shape:SolidMolecular weight:198.0255Biphenyl-4-boronic acid
CAS:Biphenyl-4-boronic acidFormula:C12H11BO2Purity:98%Color and Shape: white to off-white solidMolecular weight:198.03g/mol4-Biphenylboronic acid
CAS:4-Biphenylboronic acid is a boric acid substance widely used in medicine and other fields.
Formula:C12H11BO2Purity:99.53%Color and Shape:SolidMolecular weight:198.034-Biphenylboronic acid
CAS:4-Biphenylboronic acid is a molecule that belongs to the group of amines. It is used in plant science to study the effects of amines on plants. The molecule has been shown to have a high UV absorption and catalysis activity. 4-Biphenylboronic acid has also been shown to bind with p-hydroxybenzoic acid, which inhibits binding with proteins, leading to a change in morphology. 4-Biphenylboronic acid can be used as a chemical inhibitor for root formation and other biological functions.Formula:C12H11BO2Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:198.03 g/mol4-Biphenylboronic acid
CAS:Formula:C12H11BO2Purity:98%Color and Shape:White powderMolecular weight:198.03






