CAS 51223-59-7

N-(2-amino-4-chlorophenyl)acetamide

Description:

N-(2-amino-4-chlorophenyl)acetamide, also known by its CAS number 51223-59-7, is an organic compound characterized by its amide functional group and a substituted aromatic ring. This compound features a chlorinated phenyl group, which contributes to its chemical reactivity and potential biological activity. The presence of the amino group enhances its solubility in polar solvents and may influence its interaction with biological systems. Typically, compounds like this can exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the presence of the chlorine atom, which can affect its electronic properties and steric hindrance. Overall, N-(2-amino-4-chlorophenyl)acetamide represents a class of compounds that may serve as important intermediates or active pharmaceutical ingredients in various therapeutic contexts.

Formula: C₈H₉ClN₂O

InChI: InChI=1/C8H9ClN2O/c1-5(12)11-8-3-2-6(9)4-7(8)10/h2-4H,10H2,1H3,(H,11,12)

SMILES: CC(=Nc1ccc(cc1N)Cl)O

N-(2-Amino-4-chlorophenyl)acetamide

CAS: 51223-59-7

Formula: C₈H₉ClN₂O

Molecular weight: 184.6229

Ref: IN-DA00DD53

N-(2-Amino-4-chlorophenyl)acetamide

CAS: 51223-59-7

Versatile small molecule scaffold

Formula: C₈H₉ClN₂O

Purity: Min. 95%

Molecular weight: 184.62 g/mol

Ref: 3D-BCA22359