CAS 51226-47-2
:1,2-dimethyl-5-nitro-1H-indole
Description:
1,2-Dimethyl-5-nitro-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of two methyl groups at the 1 and 2 positions and a nitro group at the 5 position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is known for its potential applications in pharmaceuticals and organic synthesis. The nitro group is a strong electron-withdrawing group, which can influence the reactivity of the indole ring, making it a useful intermediate in various chemical reactions. Additionally, the methyl groups can affect the compound's solubility and stability. As with many nitro-substituted compounds, 1,2-dimethyl-5-nitro-1H-indole may exhibit biological activity, which warrants further investigation for potential therapeutic uses. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c1-7-5-8-6-9(12(13)14)3-4-10(8)11(7)2/h3-6H,1-2H3
SMILES:Cc1cc2cc(ccc2n1C)N(=O)=O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery