CAS 51229-51-7
:1-[4-(Bromomethyl)phenyl]ethanone
Description:
1-[4-(Bromomethyl)phenyl]ethanone, with the CAS number 51229-51-7, is an organic compound characterized by its ketone functional group and a bromomethyl substituent on a phenyl ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a molecular structure that includes a phenyl group attached to an ethanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromomethyl group enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. Additionally, this compound may exhibit moderate to low solubility in water but is generally soluble in organic solvents like ethanol and dichloromethane. Its reactivity and functional groups make it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and its potential reactivity.
Formula:C9H9BrO
InChI:InChI=1/C9H9BrO/c1-7(11)9-4-2-8(6-10)3-5-9/h2-5H,6H2,1H3
SMILES:CC(=O)c1ccc(cc1)CBr
Synonyms:- Ethanone, 1-[4-(bromomethyl)phenyl]-
- 1-(4-(Bromomethyl)Phenyl)Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(4-(Bromomethyl)phenyl)ethanone
CAS:Formula:C9H9BrOPurity:97%Color and Shape:SolidMolecular weight:213.0741-(4-(Bromomethyl)phenyl)ethanone
CAS:Formula:C9H9BrOPurity:97%Color and Shape:SolidMolecular weight:213.0712Ref: IN-DA00DHVD
1g38.00€5g99.00€10g141.00€25g214.00€100gTo inquire250gTo inquire500gTo inquire100mg28.00€250mg25.00€1-(4-(Bromomethyl)phenyl)ethanone
CAS:1-(4-(Bromomethyl)phenyl)ethanonePurity:99%Molecular weight:213.07116g/mol1-(4-(Bromomethyl)phenyl)ethanone
CAS:<p>1-(4-(Bromomethyl)phenyl)ethanone is a synthetic compound that has been used as an intermediate in the synthesis of other compounds. It can be used to synthesize stilbene derivatives, amines, and carbenes. One of its uses is the cross-coupling reaction with primary alcohols to form a triarylbismuth complex. This process is known as the Wittig reaction, which involves the formation of an aromatic ring via an intermediate carbene. The 1-(4-bromomethyl)phenyl ethanone can also be used to synthesize monomers, such as polymers and plastics.</p>Formula:C9H9BrOPurity:Min. 95%Color and Shape:PowderMolecular weight:213.07 g/mol1-(4-(Bromomethyl)phenyl)ethanone
CAS:Controlled Product<p>Applications 1-(4-(Bromomethyl)phenyl)ethanone is useful in the synthesis of series of dihydropyrimidine and thiopyrimidine derivatives as antiviral agents.<br>References Sari, O., et al.: Eur. J. Med. Chem., 104, 127-138 (2015)<br></p>Formula:C9H9BrOColor and Shape:NeatMolecular weight:213.071




