CAS 5123-26-2

N-(4-Aminocyclohexyl)-1,4-cyclohexanediamine

Description:

N-(4-Aminocyclohexyl)-1,4-cyclohexanediamine, also known by its CAS number 5123-26-2, is an organic compound characterized by its amine functional groups and cyclohexane rings. This substance features two primary amine groups, which contribute to its reactivity and potential applications in various chemical processes, particularly in the synthesis of polyurethanes and epoxy resins. The presence of the cyclohexane structure imparts a degree of rigidity and steric hindrance, influencing its physical properties such as melting point and solubility. Typically, it is a solid at room temperature and exhibits good solubility in polar solvents. The compound is known for its role as a curing agent and hardener in polymer chemistry, where it enhances the mechanical properties of the resulting materials. Additionally, due to its amine groups, it can participate in hydrogen bonding, which may affect its interactions with other chemical species. Safety precautions should be observed when handling this compound, as it may pose health risks upon exposure.

Formula: C₁₂H₂₅N₃

InChI: InChI=1/C12H25N3/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h9-12,15H,1-8,13-14H2

SMILES: C1CC(CCC1N)NC1CCC(CC1)N

Synonyms:

• 4,4'-Diaminodicyclohexylamine
• 4,4'-Iminobiscyclohexylamine
• N-(4-aminocyclohexyl)cyclohexane-1,4-diamine