CAS 5123-42-2

N-[(2S)-2-ammoniopropanoyl]glycyl-N-(carboxylatomethyl)glycinamide

Description:

N-[(2S)-2-ammoniopropanoyl]glycyl-N-(carboxylatomethyl)glycinamide, with the CAS number 5123-42-2, is a synthetic compound that belongs to the class of amino acids and peptides. This substance features a complex structure characterized by multiple functional groups, including an amine, carboxylic acid, and amide functionalities, which contribute to its biochemical properties. It is typically soluble in water due to the presence of polar groups, making it relevant in biological systems. The compound may exhibit properties such as being a zwitterion, where it carries both positive and negative charges, depending on the pH of the solution. This characteristic can influence its interaction with other biomolecules, including proteins and enzymes. Additionally, it may play a role in metabolic pathways or serve as a building block for larger peptides. Its specific applications can vary, but it is often studied in the context of biochemistry and pharmacology for potential therapeutic uses.

Formula: C₉H₁₆N₄O₅

InChI: InChI=1/C9H16N4O5/c1-5(10)9(18)13-3-7(15)11-2-6(14)12-4-8(16)17/h5H,2-4,10H2,1H3,(H,11,15)(H,12,14)(H,13,18)(H,16,17)/t5-/m0/s1

SMILES: C[C@@H](C(=NCC(=NCC(=NCC(=O)O)O)O)O)N

Synonyms:

• glycine, L-alanylglycylglycyl-
• L-Ala-Gly-Gly-Gly
• L-Alanylglycylglycylglycine

Ala-Gly-Gly-Gly-OH

CAS: 5123-42-2

Formula: C₉H₁₆N₄O₅

Purity: 99.0%

Molecular weight: 260.25

Ref: 10-F492662

H-ALA-GLY-GLY-GLY-OH

Controlled Product

CAS: 5123-42-2

Formula: C₉H₁₆N₄O₅

Color and Shape: Neat

Molecular weight: 260.247

Ref: TR-A576458