CAS 5123-98-8

5-amino-3-(propan-2-yl)-1,2,3-oxadiazol-3-ium chloride

Description:

5-Amino-3-(propan-2-yl)-1,2,3-oxadiazol-3-ium chloride is a chemical compound characterized by its oxadiazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms and three carbon atoms. The presence of an amino group and an isopropyl substituent contributes to its unique properties, including potential biological activity. This compound is typically encountered as a chloride salt, which enhances its solubility in polar solvents. It may exhibit characteristics such as moderate stability under standard conditions, but its reactivity can vary depending on the functional groups present. The oxadiazole moiety is known for its applications in pharmaceuticals and agrochemicals, often serving as a scaffold for drug development. Additionally, the compound may display interesting electrochemical properties due to the presence of the positively charged oxadiazolium ion. Overall, 5-amino-3-(propan-2-yl)-1,2,3-oxadiazol-3-ium chloride is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₅H₁₀ClN₃O

InChI: InChI=1/C5H10N3O.ClH/c1-4(2)8-3-5(6)9-7-8;/h3-4H,6H2,1-2H3;1H/q+1;/p-1

InChI key: VWFKBBVQLMSINJ-UHFFFAOYSA-M

SMILES: CC(C)[N+]1=NOC(=C1)N.[Cl-]