CAS 51234-41-4

ethyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate

Description:

Ethyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate, with the CAS number 51234-41-4, is an organic compound characterized by its complex structure, which includes an ethyl ester functional group and a benzoxazole moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the 4-chlorophenyl group suggests that it may have enhanced lipophilicity and could interact with various biological targets. Ethyl esters are generally known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the benzoxazole ring is recognized for its role in pharmaceuticals and agrochemicals, often exhibiting antimicrobial and anti-inflammatory properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, ethyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate represents a class of compounds that may have significant applications in medicinal chemistry and materials science.

Formula: C₁₈H₁₆ClNO₃

InChI: InChI=1/C18H16ClNO3/c1-3-22-18(21)11(2)13-6-9-16-15(10-13)20-17(23-16)12-4-7-14(19)8-5-12/h4-11H,3H2,1-2H3

SMILES: CCOC(=O)C(C)c1ccc2c(c1)nc(c1ccc(cc1)Cl)o2

Synonyms:

• 5-Benzoxazoleacetic Acid, 2-(4-Chlorophenyl)-Alpha-Methyl-, Ethyl Ester
• Ethyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate

Benoxaprofen Ethyl Ester

CAS: 51234-41-4

Color and Shape: Neat

Ref: 86-MM1828.02