CAS 51246-79-8
:2′,3′-Dideoxy-3′-fluorocytidine
Description:
2′,3′-Dideoxy-3′-fluorocytidine is a synthetic nucleoside analog that is primarily used in research and pharmaceutical applications, particularly in the study of antiviral and anticancer therapies. This compound is characterized by the presence of a fluorine atom at the 3' position of the ribose sugar, which replaces the hydroxyl group typically found in natural nucleosides. This modification imparts unique properties, such as increased resistance to nucleases, enhancing its potential as a therapeutic agent. The absence of the 2' hydroxyl group also contributes to its ability to inhibit viral replication by interfering with nucleic acid synthesis. 2′,3′-Dideoxy-3′-fluorocytidine has shown promise in the treatment of various viral infections, including HIV, and is being investigated for its efficacy in cancer treatment due to its ability to disrupt cellular processes. Its chemical structure allows for incorporation into RNA and DNA, making it a valuable tool in molecular biology and medicinal chemistry.
Formula:C9H12FN3O3
InChI:InChI=1S/C9H12FN3O3/c10-5-3-8(16-6(5)4-14)13-2-1-7(11)12-9(13)15/h1-2,5-6,8,14H,3-4H2,(H2,11,12,15)/t5-,6+,8+/m0/s1
InChI key:InChIKey=HNSUDSIHCJEYQG-SHYZEUOFSA-N
SMILES:O=C1N([C@@H]2O[C@H](CO)[C@@H](F)C2)C=CC(N)=N1
Synonyms:- 3′-Fluoro-2′,3′-dideoxycytidine
- Cytidine, 2′,3′-dideoxy-3′-fluoro-
- 2′,3′-Dideoxy-3′-fluorocytidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2',3'-Dideoxy-3'-fluorocytidine
CAS:Nucleoside Derivatives - 2’,3’-Dideoxy-nucleosides, Fluoro-modified nucleosides, 3’-Modified nucleosides; Drugs and Inhibitors; HIV-1 inhibitorFormula:C9H12FN3O3Color and Shape:SolidMolecular weight:229.21Ref: TM-TNU0208
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire2',3'-Dideoxy-3'-fluorocytidine
CAS:2',3'-Dideoxy-3'-fluorocytidine is a synthetic nucleoside analog that inhibits DNA synthesis by blocking the incorporation of deoxycytidine into DNA. It is used to treat lymphocytic leukemia, hepatitis, and virus infections. 2',3'-Dideoxy-3'-fluorocytidine has been shown to inhibit cell growth in solid tumours. The drug has also been shown to inhibit the production of immunodeficiency viruses such as human immunodeficiency virus type 1 (HIV-1) and human T-lymphotropic virus type I (HTLV-I), which causes acquired immune deficiency syndrome (AIDS). 2',3'-Dideoxy-3'-fluorocytidine inhibits viral replication by inhibiting the activity of the enzyme deaminase, which converts dATP to dTTP. This prevents DNA replication and transcription.Formula:C9H12FN3O3Purity:Min. 95%Molecular weight:229.21 g/mol


