CAS 51255-96-0
:trans-zeatin glucoside
Description:
Trans-zeatin glucoside is a naturally occurring cytokinin, a class of plant hormones that play a crucial role in regulating various aspects of plant growth and development. It is a glycosylated form of zeatin, which is an important compound involved in cell division and differentiation. The structure of trans-zeatin glucoside features a trans configuration of the isoprenoid side chain, which is characteristic of zeatin, and it is linked to a glucose molecule through a glycosidic bond. This compound is typically found in various plant tissues and is involved in promoting shoot growth and delaying leaf senescence. Its presence can influence processes such as nutrient mobilization and stress responses in plants. Trans-zeatin glucoside is also of interest in agricultural and horticultural applications due to its potential to enhance crop yield and quality. As a chemical substance, it is generally stable under normal conditions but may be sensitive to extreme pH levels and high temperatures, which can affect its biological activity.
Formula:C16H23N5O6
InChI:InChI=1/C16H23N5O6/c1-8(4-22)2-3-17-14-10-15(19-6-18-14)21(7-20-10)16-13(26)12(25)11(24)9(5-23)27-16/h2,6-7,9,11-13,16,22-26H,3-5H2,1H3,(H,17,18,19)/b8-2+/t9-,11-,12+,13-,16-/m1/s1
Synonyms:- 9-beta-D-glucopyranosyl-N-[(2E)-4-hydroxy-3-methylbut-2-en-1-yl]-9H-purin-6-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
trans-Zeatin-9-glucoside
CAS:trans-Zeatin-9-glucosideColor and Shape:SolidMolecular weight:381.38g/moltrans-Zeatin-9-glucoside
CAS:Controlled ProductFormula:C16H23N5O6Color and Shape:NeatMolecular weight:381.384trans-Zeatin-9-glucoside
CAS:<p>Trans-zeatin-9-glucoside is a natural product that is produced by plants and is known to have a variety of biological activities. Trans-zeatin-9-glucoside has been shown to affect plant growth and development, as well as the immune system. It has also been shown to exhibit antioxidant activity and inhibit cancer cell proliferation. Trans-zeatin-9-glucoside has been found in barley, wheat, rye, oat straw, corn stover, soybean leaves, potato tubers, and composts. The biosynthesis of this compound begins with the conversion of zeatin into zeaxanthin via a series of enzymatic reactions. Zeaxanthin is then converted into trans-zeatin-9-glucoside through the action of an enzyme called β--cyclodextrin glucanotransferase.</p>Formula:C16H23N5O6Purity:Min. 98 Area-%Color and Shape:Colorless PowderMolecular weight:381.38 g/mol


