CAS 51268-88-3
:(1R,2S)-1,2-Dihydro-1,2-naphthalenediol
Description:
(1R,2S)-1,2-Dihydro-1,2-naphthalenediol, with the CAS number 51268-88-3, is an organic compound characterized by its bicyclic structure derived from naphthalene. This compound features two hydroxyl (-OH) groups attached to the first and second carbon atoms of the naphthalene ring system, which contributes to its diol classification. The stereochemistry indicated by (1R,2S) specifies the spatial arrangement of the substituents around the chiral centers, influencing its physical and chemical properties. Typically, diols exhibit increased polarity due to the presence of hydroxyl groups, which can lead to enhanced solubility in polar solvents and potential hydrogen bonding interactions. This compound may be of interest in various chemical applications, including organic synthesis and as a potential intermediate in the production of more complex molecules. Its specific reactivity and applications would depend on the context of its use, including potential roles in pharmaceuticals or materials science.
Formula:C10H10O2
InChI:InChI=1/C10H10O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,9-12H/t9-,10+/m0/s1
InChI key:InChIKey=QPUHWUSUBHNZCG-VHSXEESVSA-N
SMILES:O[C@@H]1C=2C(C=C[C@@H]1O)=CC=CC2
Synonyms:- (+)-cis-1(R),2(S)-Dihydroxy-1,2-dihydronaphthalene
- (+)-cis-1(R)-3-(S)-Dihydroxy-1,2-dihydronaphthalene
- (1R,2S)-1,2-Dihydro-1,2-naphthalenediol
- (1R,2S)-1,2-dihydronaphthalene-1,2-diol
- (1R,2S)-cis-1,2-Dihydro-1,2-naphthalenediol
- (1R-cis)-1,2-dihydro-1,2-naphthalenediol
- 1,2-Naphthalenediol, 1,2-dihydro-, (1R,2S)-
- 1,2-Naphthalenediol, 1,2-dihydro-, (1R-cis)-
- cis-(1R,2S)-1,2-Dihydro-1,2-dihydroxynaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(+)-(1R,2S)-1,2-Dihydro-1,2-naphthalenediol
CAS:Controlled ProductFormula:C10H10O2Color and Shape:NeatMolecular weight:162.185
