CAS 51274-66-9
:1,1'-dimethyl-1,1',2,2',3,3',6,6'-octahydro-4,4'-bipyridine
Description:
1,1'-Dimethyl-1,1',2,2',3,3',6,6'-octahydro-4,4'-bipyridine, with CAS number 51274-66-9, is a bicyclic organic compound characterized by its unique structure that features two fused piperidine rings. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits a relatively low volatility and is soluble in organic solvents, making it useful in various chemical applications. The presence of multiple nitrogen atoms in its structure contributes to its basicity and potential reactivity, particularly in nucleophilic substitution reactions. Additionally, it may serve as a ligand in coordination chemistry or as an intermediate in organic synthesis. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, its distinctive structural features and chemical properties make it of interest in both industrial and research settings.
Formula:C12H20N2
InChI:InChI=1/C12H20N2/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12/h3,5H,4,6-10H2,1-2H3
Synonyms:- 1,1'-Dimethyl-1,1',2,2',3,3',6,6'-octahydro-4,4'-bipyridine
- 4,4'-bipyridine, 1,1',2,2',3,3',6,6'-octahydro-1,1'-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
