CAS 51276-85-8
:2-amino-1H-benzimidazol-6-ol
Description:
2-Amino-1H-benzimidazol-6-ol, with the CAS number 51276-85-8, is an organic compound characterized by its benzimidazole core structure, which consists of a fused benzene and imidazole ring. This compound features an amino group (-NH2) and a hydroxyl group (-OH) at specific positions on the ring, contributing to its chemical reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydroxyl group. The compound may exhibit properties such as being a weak base, and it can participate in hydrogen bonding, which influences its solubility and interaction with other molecules. 2-Amino-1H-benzimidazol-6-ol has garnered interest in medicinal chemistry for its potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. Its structural features allow for various modifications, making it a versatile scaffold in drug design.
Formula:C7H7N3O
InChI:InChI=1/C7H7N3O/c8-7-9-5-2-1-4(11)3-6(5)10-7/h1-3,11H,(H3,8,9,10)
SMILES:c1cc2c(cc1O)[nH]c(=N)[nH]2
Synonyms:- 1H-benzimidazol-5-ol, 2-amino-
- 2-Amino-1H-benzimidazol-5-ol
- 2-Amino-5-hydroxybenzimidazole
- 2-Amino-5-Hydroxy-Benzimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Benzimidazol-5-ol,2-amino-(9CI)
CAS:Formula:C7H7N3OPurity:97%Color and Shape:SolidMolecular weight:149.15002-Amino-1H-benzo[d]imidazol-5-ol
CAS:Formula:C7H7N3OPurity:97%Color and Shape:SolidMolecular weight:149.1532-Amino-1H-benzo[d]imidazol-5-ol
CAS:2-Amino-1H-benzo[d]imidazol-5-ol is a serine protease inhibitor that blocks the enzyme urokinase type plasminogen activator (uPA), preventing the activation of plasminogen to plasmin. It has been shown to inhibit tumor cell growth in vitro and in vivo. 2-Amino-1H-benzo[d]imidazol-5-ol is also used as an intermediate for the synthesis of conjugates, which are molecules used to target cancer cells. In addition, 2-Amino-1H-benzo[d]imidazol-5-ol is a pharmacokinetic agent that can be used to monitor drug concentrations in the body.
Formula:C7H7N3OPurity:Min. 95%Molecular weight:149.15 g/mol





