CAS 512776-10-2

1-[1-(4-chlorophenyl)ethyl]piperazine

Description:

1-[1-(4-chlorophenyl)ethyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 4-chlorophenyl group and an ethyl substituent, contributing to its unique properties. It is typically classified as an organic compound and may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the chlorophenyl group can influence its lipophilicity and interaction with biological targets, potentially affecting its pharmacokinetics and pharmacodynamics. The compound's structure suggests it may engage in hydrogen bonding and other intermolecular interactions, which are crucial for its solubility and reactivity. Additionally, the piperazine moiety is known for its role in various therapeutic agents, particularly in the treatment of psychiatric disorders. As with many chemical substances, safety and handling precautions are essential, as it may possess toxicological properties that require careful assessment in laboratory and industrial settings.

Formula: C₁₂H₁₇ClN₂

InChI: InChI=1/C12H17ClN2/c1-10(15-8-6-14-7-9-15)11-2-4-12(13)5-3-11/h2-5,10,14H,6-9H2,1H3

SMILES: CC(c1ccc(cc1)Cl)N1CCNCC1

Synonyms:

• Piperazine, 1-[1-(4-chlorophenyl)ethyl]-

1-(1-(4-Chlorophenyl)ethyl)piperazine

CAS: 512776-10-2

Formula: C₁₂H₁₇ClN₂

Purity: 95%

Molecular weight: 224.7298

Ref: IN-DA00DD36

1-[1-(4-Chloro-phenyl)-ethyl]-piperazine

Controlled Product

CAS: 512776-10-2

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClN₂

Purity: Min. 95%

Molecular weight: 224.73 g/mol

Ref: 3D-MVA77610