CAS 512809-18-6

4-Bromo-3,5-dimethyl-1H-pyrazole-1-propanoic acid hydrazide

Description:

4-Bromo-3,5-dimethyl-1H-pyrazole-1-propanoic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with bromine and methyl groups, along with a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and pyrazoles, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the bromine atom may enhance its reactivity and influence its interaction with biological targets. The hydrazide moiety can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. Its applications may extend to pharmaceuticals, agrochemicals, or as a research tool in biochemical studies. As with many chemical substances, safety precautions should be observed when handling it, and its environmental impact should be considered in any practical applications.

Formula: C₈H₁₃BrN₄O

InChI: InChI=1S/C8H13BrN4O/c1-5-8(9)6(2)13(12-5)4-3-7(14)11-10/h3-4,10H2,1-2H3,(H,11,14)

InChI key: InChIKey=AUVRVCHPAVPNPM-UHFFFAOYSA-N

SMILES: C(CC(NN)=O)N1C(C)=C(Br)C(C)=N1

Synonyms:

• 4-Bromo-3,5-dimethyl-1H-pyrazole-1-propanoic acid hydrazide
• 1H-Pyrazole-1-propanoic acid, 4-bromo-3,5-dimethyl-, hydrazide