CAS 512809-58-4
:3-[(4-Bromo-3-nitro-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide
Description:
3-[(4-Bromo-3-nitro-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety linked to a hydrazide functional group. The presence of a 4-bromo and a 3-nitro substituent on the pyrazole ring contributes to its potential reactivity and biological activity. This compound is likely to exhibit properties typical of hydrazides, such as the ability to form hydrazones and participate in various chemical reactions, including condensation and oxidation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. Additionally, the bromine and nitro groups may enhance its lipophilicity and influence its interaction with biological targets. As with many compounds containing halogens and nitro groups, it may also exhibit specific toxicological properties, necessitating careful handling and assessment in laboratory settings. Overall, this compound represents a unique entity in the realm of organic chemistry with potential implications in drug design and development.
Formula:C11H10BrN5O3
InChI:InChI=1S/C11H10BrN5O3/c12-9-6-16(15-10(9)17(19)20)5-7-2-1-3-8(4-7)11(18)14-13/h1-4,6H,5,13H2,(H,14,18)
InChI key:InChIKey=PATDKLICDVZJBL-UHFFFAOYSA-N
SMILES:C(N1N=C(N(=O)=O)C(Br)=C1)C2=CC(C(NN)=O)=CC=C2
Synonyms:- 3-[(4-Bromo-3-nitro-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide
- Benzoic acid, 3-[(4-bromo-3-nitro-1H-pyrazol-1-yl)methyl]-, hydrazide
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery