CAS 512809-67-5

3-Methoxy-α-methyl-4-nitro-1H-pyrazole-1-acetic acid

Description:

3-Methoxy-α-methyl-4-nitro-1H-pyrazole-1-acetic acid, with the CAS number 512809-67-5, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a methoxy group (-OCH3) and a nitro group (-NO2) that contribute to its chemical reactivity and potential biological activity. The presence of the α-methyl group enhances its lipophilicity, which can influence its pharmacokinetic properties. The acetic acid moiety provides acidic characteristics, allowing for potential interactions in biological systems. This compound may exhibit various properties such as solubility in organic solvents, and its stability can be influenced by environmental factors like pH and temperature. Due to its structural features, it may be of interest in medicinal chemistry for the development of pharmaceuticals, particularly in the context of anti-inflammatory or analgesic agents. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₇H₉N₃O₅

InChI: InChI=1S/C7H9N3O5/c1-4(7(11)12)9-3-5(10(13)14)6(8-9)15-2/h3-4H,1-2H3,(H,11,12)

InChI key: InChIKey=JKGIOJTWKOZSKL-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C)N1C=C(N(=O)=O)C(OC)=N1

Synonyms:

• 1H-Pyrazole-1-acetic acid, 3-methoxy-α-methyl-4-nitro-
• 3-Methoxy-α-methyl-4-nitro-1H-pyrazole-1-acetic acid

2-(3-Methoxy-4-nitro-1H-pyrazol-1-yl)propanoic acid

CAS: 512809-67-5

Versatile small molecule scaffold

Formula: C₇H₉N₃O₅

Purity: Min. 95%

Molecular weight: 215.16 g/mol

Ref: 3D-MVA80967