CAS 512809-81-3
:4-Bromo-1-methyl-1H-pyrazole-5-carboxylic acid hydrazide
Description:
4-Bromo-1-methyl-1H-pyrazole-5-carboxylic acid hydrazide is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a methyl group at the 1-position contributes to its unique reactivity and potential applications in medicinal chemistry. The carboxylic acid hydrazide functional group enhances its ability to form hydrogen bonds, making it a candidate for various biological activities. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer effects, although specific biological activities would depend on further empirical studies. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the bromine and hydrazide groups, which may affect its behavior in different solvents and under varying conditions. Overall, 4-Bromo-1-methyl-1H-pyrazole-5-carboxylic acid hydrazide represents a versatile scaffold in organic synthesis and pharmaceutical research.
Formula:C5H7BrN4O
InChI:InChI=1S/C5H7BrN4O/c1-10-4(5(11)9-7)3(6)2-8-10/h2H,7H2,1H3,(H,9,11)
InChI key:InChIKey=COLPSAPAKXEHAJ-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=C(Br)C=NN1C
Synonyms:- 4-Bromo-1-methyl-1H-pyrazole-5-carboxylic acid hydrazide
- 1H-Pyrazole-5-carboxylic acid, 4-bromo-1-methyl-, hydrazide
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery