CymitQuimica logo

CAS 512809-82-4

:

3-Methyl-1H-pyrazole-1-propanoic acid hydrazide

Description:
3-Methyl-1H-pyrazole-1-propanoic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a hydrazide functional group. This compound typically exhibits properties associated with both pyrazole derivatives and hydrazides, such as potential biological activity and the ability to form hydrogen bonds due to the presence of the hydrazide moiety. It may be soluble in polar solvents, reflecting the hydrophilic nature of the hydrazide group, while the pyrazole ring can contribute to its stability and reactivity. The compound's molecular structure suggests it may participate in various chemical reactions, including those typical of hydrazides, such as condensation and acylation reactions. Additionally, derivatives of pyrazole compounds are often investigated for their pharmacological properties, including anti-inflammatory and antimicrobial activities. However, specific applications and biological activities would require further investigation and validation through experimental studies. Overall, 3-Methyl-1H-pyrazole-1-propanoic acid hydrazide represents a compound of interest in both synthetic chemistry and potential medicinal applications.
Formula:C7H12N4O
InChI:InChI=1S/C7H12N4O/c1-6-2-4-11(10-6)5-3-7(12)9-8/h2,4H,3,5,8H2,1H3,(H,9,12)
InChI key:InChIKey=ZLZBYPNUAKMWNR-UHFFFAOYSA-N
SMILES:C(CC(NN)=O)N1C=CC(C)=N1
Synonyms:
  • 1H-Pyrazole-1-propanoic acid, 3-methyl-, hydrazide
  • 3-Methyl-1H-pyrazole-1-propanoic acid hydrazide
Found 0 products.