CAS 512809-86-8

5-(Difluoromethyl)-3-methyl-1H-pyrazole-1-acetic acid

Description:

5-(Difluoromethyl)-3-methyl-1H-pyrazole-1-acetic acid is a chemical compound characterized by its unique pyrazole structure, which includes a difluoromethyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both pyrazole derivatives and carboxylic acids, such as moderate solubility in polar solvents and potential reactivity due to the presence of the carboxylic acid group. The difluoromethyl group can influence the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry and agrochemical applications. Its molecular structure allows for various interactions, including hydrogen bonding and dipole-dipole interactions, which can affect its behavior in biological systems. Additionally, the presence of fluorine atoms often enhances metabolic stability and alters pharmacokinetic properties. Overall, this compound's characteristics make it a subject of interest for further research in drug development and chemical synthesis.

Formula: C₇H₈F₂N₂O₂

InChI: InChI=1S/C7H8F2N2O2/c1-4-2-5(7(8)9)11(10-4)3-6(12)13/h2,7H,3H2,1H3,(H,12,13)

InChI key: InChIKey=GTLVEURABDVIGB-UHFFFAOYSA-N

SMILES: C(F)(F)C=1N(CC(O)=O)N=C(C)C1

Synonyms:

• 5-(Difluoromethyl)-3-methyl-1H-pyrazole-1-acetic acid
• 2-[5-(Difluoromethyl)-3-methyl-1H-pyrazol-1-yl]acetic acid
• [5-(Difluoromethyl)-3-methyl-1H-pyrazol-1-yl]acetic acid
• 1H-Pyrazole-1-acetic acid, 5-(difluoromethyl)-3-methyl-

[5-(Difluoromethyl)-3-methyl-1H-pyrazol-1-yl]acetic acid

CAS: 512809-86-8

[5-(Difluoromethyl)-3-methyl-1H-pyrazol-1-yl]acetic acid

Purity: 95%

Molecular weight: 190.15g/mol

Ref: 54-PC900732

[5-(Difluoromethyl)-3-methyl-1H-pyrazol-1-yl]acetic acid

CAS: 512809-86-8

Versatile small molecule scaffold

Formula: C₇H₈F₂N₂O₂

Purity: Min. 95%

Molecular weight: 190.15 g/mol

Ref: 3D-MVA80986