CAS 512809-99-3

5-[(4-Bromo-3-nitro-1H-pyrazol-1-yl)methyl]-2-furancarboxaldehyde

Description:

5-[(4-Bromo-3-nitro-1H-pyrazol-1-yl)methyl]-2-furancarboxaldehyde is a chemical compound characterized by its unique structural features, which include a furan ring and a pyrazole moiety. The presence of a bromine atom and a nitro group on the pyrazole contributes to its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water due to its complex structure. The aldehyde functional group is reactive, making it a potential candidate for further chemical modifications or reactions, such as condensation or reduction. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heterocyclic rings that are often associated with bioactive compounds. Additionally, the compound's unique combination of functional groups may impart specific electronic and steric properties, influencing its interactions in biological systems or chemical reactions. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in various fields.

Formula: C₉H₆BrN₃O₄

InChI: InChI=1S/C9H6BrN3O4/c10-8-4-12(11-9(8)13(15)16)3-6-1-2-7(5-14)17-6/h1-2,4-5H,3H2

InChI key: InChIKey=BVNLECJBXUWKMF-UHFFFAOYSA-N

SMILES: C(N1N=C(N(=O)=O)C(Br)=C1)C=2OC(C=O)=CC2

Synonyms:

• 5-[(4-Bromo-3-nitro-1H-pyrazol-1-yl)methyl]-2-furancarboxaldehyde
• 2-Furancarboxaldehyde, 5-[(4-bromo-3-nitro-1H-pyrazol-1-yl)methyl]-

5-[(4-Bromo-3-nitro-1H-pyrazol-1-yl)methyl]furan-2-carbaldehyde

CAS: 512809-99-3

Versatile small molecule scaffold

Formula: C₉H₆BrN₃O₄

Purity: Min. 95%

Molecular weight: 300.07 g/mol

Ref: 3D-MVA80999