CAS 512823-86-8

4-Bromo-1-[(2-fluorophenyl)methyl]-3-nitro-1H-pyrazole

Description:

4-Bromo-1-[(2-fluorophenyl)methyl]-3-nitro-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a bromine atom, a nitro group, and a 2-fluorophenylmethyl group. The presence of the bromine atom contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The nitro group is known for its electron-withdrawing properties, which can influence the compound's electronic characteristics and reactivity. The 2-fluorophenylmethyl moiety adds to the compound's lipophilicity and may enhance its biological activity. This compound is of interest in various fields, including pharmaceuticals, where it may serve as a lead compound for the development of new drugs. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug discovery and development. As with many chemical substances, safety and handling precautions should be observed due to the presence of halogens and nitro groups, which can pose health and environmental risks.

Formula: C₁₀H₇BrFN₃O₂

InChI: InChI=1S/C10H7BrFN3O2/c11-8-6-14(13-10(8)15(16)17)5-7-3-1-2-4-9(7)12/h1-4,6H,5H2

InChI key: InChIKey=WPZOPWRLSSGZDC-UHFFFAOYSA-N

SMILES: C(N1N=C(N(=O)=O)C(Br)=C1)C2=C(F)C=CC=C2

Synonyms:

• 4-Bromo-1-[(2-fluorophenyl)methyl]-3-nitro-1H-pyrazole
• 1H-Pyrazole, 4-bromo-1-[(2-fluorophenyl)methyl]-3-nitro-

4-Bromo-1-(2-fluoro-benzyl)-3-nitro-1H-pyrazole

CAS: 512823-86-8

Formula: C₁₀H₇BrFN₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 300.087

Ref: 10-F025678