CAS 51285-13-3
:N'-Hydroxycyclopropanecarboximidamide
Description:
N'-Hydroxycyclopropanecarboximidamide is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and an imidamide functional group. This compound typically exhibits properties associated with both amides and hydroxyl groups, potentially influencing its reactivity and solubility in various solvents. The presence of the hydroxyl group may impart some degree of polarity, while the cyclopropane ring can contribute to ring strain, affecting the compound's stability and reactivity. N'-Hydroxycyclopropanecarboximidamide may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it of interest in synthetic organic chemistry. Its specific applications can vary, but it may be explored in the development of pharmaceuticals or agrochemicals due to its structural features. As with many chemical substances, safety and handling precautions should be observed, as the compound may exhibit toxicity or other hazardous properties. Always refer to safety data sheets and relevant literature for detailed information on handling and potential applications.
Formula:C4H8N2O
InChI:InChI=1/C4H8N2O/c5-4(6-7)3-1-2-3/h3,7H,1-2H2,(H2,5,6)
SMILES:C1CC1C(=N)NO
Synonyms:- (Z)-N'-hydroxycyclopropanecarboxamidine
- Cyclopropanecarboxamide oxime
- N'-hydroxycyclopropanecarboxamidine
- N-Hydroxycyclopropanecarboximidamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N'-Hydroxycyclopropanecarboximidamide
CAS:Formula:C4H8N2OPurity:95%Color and Shape:SolidMolecular weight:100.1191N-Hydroxy-cyclopropanecarboxamidine
CAS:N-Hydroxy-cyclopropanecarboxamidinePurity:95%Molecular weight:100.12g/mol(Z)-N'-Hydroxycyclopropanecarboxamidine
CAS:Purity:97.0%Color and Shape:Liquid, OilMolecular weight:100.121N'-Hydroxycyclopropanecarboximidamide
CAS:N'-Hydroxycyclopropanecarboximidamide (N-HCPC) is an alkoxycarbonyl-containing heterocycle that is structurally related to the benzodiazepine class of drugs. It has been shown to have depressant activity in animal models and may be useful as a treatment for epilepsy, but it also has psychoactive properties. N-HCPC can cause epileptic seizures in humans, although this effect appears to be dose dependent. It may also have potential use as a treatment for Alzheimer's disease and depression due to its ability to bind to the benzodiazepine receptor. The drug binds with high affinity to muscle tissue, which may explain its effects on muscle control and movement.Formula:C4H8N2OPurity:Min. 95%Molecular weight:100.12 g/mol



