CAS 5129-65-7: methyl 10-methyldodecanoate

Description:Methyl 10-methyldodecanoate, with the CAS number 5129-65-7, is an ester derived from the reaction of methanol and 10-methyldodecanoic acid. This compound typically appears as a colorless to pale yellow liquid with a characteristic fatty odor. It is part of the fatty acid methyl ester family, which are known for their applications in various industries, including cosmetics, food flavoring, and as solvents. The molecular structure features a long hydrocarbon chain, contributing to its hydrophobic properties and relatively low solubility in water. Methyl 10-methyldodecanoate is generally stable under normal conditions but may undergo hydrolysis in the presence of strong acids or bases. Its physical properties, such as boiling point and density, are influenced by the length of the carbon chain and the presence of functional groups. As with many esters, it may exhibit low toxicity, but safety data should be consulted for handling and exposure guidelines. Overall, this compound is of interest for its potential applications in various chemical processes and formulations.

Formula:C₁₄H₂₈O₂

InChI:InChI=1/C14H28O2/c1-4-13(2)11-9-7-5-6-8-10-12-14(15)16-3/h13H,4-12H2,1-3H3