CAS 5129-72-6
:Ethylpropionamide; 99%
Description:
Ethylpropionamide, with the CAS number 5129-72-6, is an organic compound classified as an amide. It is characterized by the presence of an ethyl group attached to the nitrogen atom of the amide functional group, which contributes to its unique properties. This compound typically appears as a colorless to pale yellow liquid with a characteristic odor. Ethylpropionamide is soluble in organic solvents and exhibits moderate polarity due to the presence of the amide functional group. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The compound is stable under normal conditions but should be handled with care, as it may pose health risks if inhaled or ingested. Safety data sheets should be consulted for specific handling and storage recommendations. Overall, ethylpropionamide is a versatile chemical with applications in various fields, including medicinal chemistry and industrial processes.
Formula:C5H11NO
InChI:InChI=1/C5H11NO/c1-3-5(7)6-4-2/h3-4H2,1-2H3,(H,6,7)
SMILES:CCC(=NCC)O
Synonyms:- N-Ethylpropionamide
- N-ethylpropanamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Ethylpropionamide
CAS:Formula:C5H11NOPurity:>99.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:101.15N-Ethylpropionamide
CAS:N-Ethylpropionamide is an organic molecule that has a hydrogen bond with the solute. The functional theory explains that the frequency shift of the solute's vibration is dependent on the concentration of the solute and the solvent. High salt concentrations can cause a change in the vibrational frequency, which may be due to a strain in the water molecules. Hydrated N-Ethylpropionamide has been found to have constant volume under high salt conditions, while chloride ions can cause changes in volume. Reaction intermediates are often hydrogen bonded as well as amide groups. Intermolecular hydrogen bonds occur between two different molecules, such as an amide group and a chloride ion.Formula:C5H11NOPurity:Min. 95%Molecular weight:101.15 g/mol




