CAS 51292-41-2

Ethyl 4-bromo-α-methyl-1H-pyrazole-1-acetate

Description:

Ethyl 4-bromo-α-methyl-1H-pyrazole-1-acetate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a bromine atom at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. The ethyl acetate functional group enhances its solubility in organic solvents, making it useful in synthetic chemistry. This compound is typically utilized in the synthesis of other organic molecules and may exhibit biological activity, although specific biological properties would depend on further studies. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, given the importance of pyrazole derivatives in these fields. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts. Proper safety measures should be observed when working with this substance in a laboratory setting.

Formula: C₈H₁₁BrN₂O₂

InChI: InChI=1S/C8H11BrN2O2/c1-3-13-8(12)6(2)11-5-7(9)4-10-11/h4-6H,3H2,1-2H3

InChI key: InChIKey=VBOJPCJNZNNSHL-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(C)N1N=CC(Br)=C1

Synonyms:

• Ethyl 4-bromo-α-methyl-1H-pyrazole-1-acetate
• 1H-Pyrazole-1-acetic acid, 4-bromo-α-methyl-, ethyl ester