CAS 51293-47-1
:Boc-Ser(Me)-OH
Description:
Boc-Ser(Me)-OH, also known as N-Boc-Serine methyl ester, is a derivative of the amino acid serine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group on the amino group and a methyl ester on the carboxylic acid group. This compound is typically used in peptide synthesis and organic chemistry as a building block due to its ability to protect functional groups during reactions. The Boc group provides stability and protects the amine from unwanted reactions, while the methyl ester facilitates the coupling reactions necessary for peptide formation. Boc-Ser(Me)-OH is generally a white to off-white solid and is soluble in common organic solvents. Its reactivity is influenced by the presence of the Boc and methyl ester groups, allowing for selective deprotection and further functionalization. As with many chemical substances, proper handling and storage are essential, as it may have specific safety and toxicity considerations.
Formula:C9H17NO5
InChI:InChI=1/C9H17NO5/c1-9(2,3)15-8(13)10-6(5-14-4)7(11)12/h6H,5H2,1-4H3,(H,10,13)(H,11,12)/t6-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](COC)C(=O)O)O
Synonyms:- N-(tert-butoxycarbonyl)-O-methyl-L-serine
- Boc-Ser(Me)-OH・DCHA
- (S)-2-((Tert-Butoxycarbonyl)Amino)-3-Methoxypropanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Boc-O-methyl-L-serine, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H17NO5Purity:97%Color and Shape:White, SolidMolecular weight:219.24(2S)-2-Amino-3-methoxypropanoic acid, N-BOC protected
CAS:<p>(2S)-2-Amino-3-methoxypropanoic acid, N-BOC protected</p>Formula:C9H17NO5Purity:≥95%Color and Shape: white to off-white solidMolecular weight:219.23g/mol
