CAS 51294-33-8

4-Cyano-2-(4-pyridinyl)-1H-imidazole-5-carboxamide

Description:

4-Cyano-2-(4-pyridinyl)-1H-imidazole-5-carboxamide, with the CAS number 51294-33-8, is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a cyano group (-CN) and a carboxamide group (-CONH2) that contribute to its chemical reactivity and potential biological activity. The presence of a pyridine ring enhances its solubility and interaction with biological systems, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. Additionally, the presence of functional groups allows for various chemical modifications, which can lead to derivatives with enhanced properties. As with many heterocycles, it may also exhibit interesting electronic properties, making it a candidate for further research in material science and organic electronics.

Formula: C₁₀H₇N₅O

InChI: InChI=1S/C10H7N5O/c11-5-7-8(9(12)16)15-10(14-7)6-1-3-13-4-2-6/h1-4H,(H2,12,16)(H,14,15)

InChI key: InChIKey=RNHPHGRIKASHLW-UHFFFAOYSA-N

SMILES: C(N)(=O)C=1NC(=NC1C#N)C=2C=CN=CC2

Synonyms:

• 1H-Imidazole-4-carboxamide, 5-cyano-2-(4-pyridinyl)-
• 4-Cyano-2-(4-pyridinyl)-1H-imidazole-5-carboxamide
• 1H-Imidazole-5-carboxamide, 4-cyano-2-(4-pyridinyl)-
• 5-Cyano-2-(4-pyridyl)-4-imidazolecarboxamide