CAS 51296-39-0
:1-amino-1-deoxy-D-fructopyranose
Description:
1-Amino-1-deoxy-D-fructopyranose is a monosaccharide derivative of fructose, characterized by the presence of an amino group replacing a hydroxyl group at the C-1 position of the sugar molecule. This modification imparts unique properties to the compound, influencing its reactivity and biological activity. The structure features a six-membered pyranose ring, typical of many sugars, which contributes to its stability and solubility in water. As an amino sugar, it can participate in various biochemical processes, including glycosylation reactions, which are crucial for the formation of glycoproteins and glycolipids. The compound may exhibit different physical properties compared to its parent sugar, such as altered melting points and solubility characteristics. Additionally, 1-amino-1-deoxy-D-fructopyranose may play a role in metabolic pathways and could be of interest in research related to carbohydrate chemistry, nutrition, and potential therapeutic applications. Its CAS number, 51296-39-0, allows for easy identification in chemical databases and literature.
Formula:C6H13NO5
InChI:InChI=1/C6H13NO5/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,8-11H,1-2,7H2/t3-,4-,5+,6?/m1/s1
Synonyms:- 1-Amino-1-deoxy-D-fructose
- 1-Amino-1-deoxy-L-fructopyranose
- 1-amino-1-deoxy-L-sorbopyranose
- L-sorbopyranose, 1-amino-1-deoxy-
- (2S,3S,5S)-2-(aminomethyl)tetrahydropyran-2,3,4,5-tetrol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Amino-1-deoxy-D-fructose hydrochloride
CAS:Formula:C6H14ClNO5Purity:≥ 95.0%Color and Shape:White to light yellow or beige powder or crystalsMolecular weight:215.61-Amino-1-deoxy-D-psicose hydrochloride
CAS:1-Amino-1-deoxy-D-psicose hydrochloride is a Glycosylation product with the CAS No. 51296-39-0(free basis). It is a white crystalline powder that is soluble in water and ethanol, but insoluble in ether. This compound is used for complex carbohydrate synthesis, methylation, click modification, polysaccharide modification, fluorination, saccharide modification, sugar modification and oligosaccharide synthesis. The purity of this product ranges from 98% to 99%, and it can be customized depending on the customer's needs.Formula:C6H13NO5·HClPurity:Min. 95%Molecular weight:215.63 g/mol

