CAS 513-77-9: Barium carbonate

Description:Barium carbonate (BaCO₃) is an inorganic compound characterized by its white crystalline solid form. It is insoluble in water but soluble in acids, where it reacts to form barium ions and carbon dioxide. Barium carbonate is primarily used in the manufacturing of ceramics, glass, and as a precursor for other barium compounds. It is also utilized in the production of certain types of pigments and as a flux in metallurgy. The compound has a relatively low toxicity compared to other barium salts, but it can still pose health risks if ingested or inhaled in significant quantities. Barium carbonate can be produced through various methods, including the reaction of barium sulfide with sodium carbonate. Its structure features a three-dimensional network of barium ions coordinated by carbonate groups, contributing to its stability and solid-state properties. Additionally, it has applications in the oil and gas industry as a weighting agent in drilling fluids. Proper handling and safety measures are essential when working with this compound to mitigate any potential hazards.

Formula:CH₂O₃·Ba

InChI:InChI=1S/CH2O3.Ba/c2-1(3)4;/h(H2,2,3,4);

InChI key:InChIKey=RUFJMLKBWUXJMX-UHFFFAOYSA-N

SMILES:[Ba].O=C(O)O