CAS 51317-41-0
:Dopamine 3-O-sulfate
Description:
Dopamine 3-O-sulfate is a sulfate ester derivative of dopamine, a neurotransmitter that plays a crucial role in various physiological functions, including mood regulation and motor control. This compound is characterized by the presence of a sulfate group attached to the hydroxyl group at the 3-position of the dopamine molecule. It is typically found in biological systems and is involved in the metabolism of dopamine, influencing its bioavailability and activity. The molecular structure of dopamine 3-O-sulfate contributes to its solubility in water, making it relevant in biochemical processes. As a metabolite, it may serve as a marker for dopamine metabolism and has potential implications in neuropharmacology and the study of neurological disorders. Its CAS number, 51317-41-0, is a unique identifier used to facilitate the identification of this specific chemical substance in scientific literature and databases. Overall, dopamine 3-O-sulfate is significant in both research and clinical contexts, particularly in understanding the dynamics of neurotransmitter regulation.
Formula:C8H11NO5S
InChI:InChI=1S/C8H11NO5S/c9-4-3-6-1-2-7(10)8(5-6)14-15(11,12)13/h1-2,5,10H,3-4,9H2,(H,11,12,13)
InChI key:InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)O)C1=CC(CCN)=CC=C1O
Synonyms:- Dopamine 3-O-sulfate
- Dopamine 3-sulfate
- Dopamine sulfate
- Dopamine3-sulfate
- Pyrocatechol, 4-(2-aminoethyl)-, 2-(hydrogen sulfate)
- Pyrocatechol,4-(2-aminoethyl)-, 2-(hydrogen sulfate) (7CI)
- [5-(2-Aminoethyl)-2-hydroxyphenyl]oxidanesulfonic acid
- 1,2-Benzenediol, 4-(2-aminoethyl)-, 2-(hydrogen sulfate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Dopamine 3-O-sulfate
CAS:Dopamine 3-O-sulfate is a sulphonated metabolite of dopamine primarily present in plasma.
Formula:C8H11NO5SColor and Shape:SolidMolecular weight:233.24Dopamine 3-O-Sulfate
CAS:Applications Dopamine 3-O-Sulfate, is a metabolite of Dopamine (D533780), that has been shown to have the hypotensive effects in anesthetized rats.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Minami, M., et al.: Biogenic Amines, 11(6), 487 (1995);Formula:C8H11NO5SColor and Shape:NeatMolecular weight:233.24



