CAS 5132-81-0

9-Acridinecarboxylic acid, methyl ester

Description:

9-Acridinecarboxylic acid, methyl ester, with the CAS number 5132-81-0, is an organic compound characterized by its acridine backbone, which is a nitrogen-containing heterocyclic aromatic compound. This substance features a carboxylic acid functional group that is esterified with a methyl group, contributing to its solubility and reactivity. It typically appears as a solid or crystalline substance and is known for its potential applications in pharmaceuticals, particularly in the development of antimicrobial and anticancer agents due to its ability to intercalate with DNA. The compound exhibits moderate to high stability under standard conditions but may be sensitive to strong acids or bases. Its molecular structure allows for various chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, 9-acridinecarboxylic acid, methyl ester can be analyzed using techniques such as NMR and mass spectrometry to confirm its identity and purity. Safety data should be consulted to handle the compound appropriately, as it may pose health risks if ingested or inhaled.

Formula: C₁₅H₁₁NO₂

InChI: InChI=1S/C15H11NO2/c1-18-15(17)14-10-6-2-4-8-12(10)16-13-9-5-3-7-11(13)14/h2-9H,1H3

InChI key: InChIKey=PGWHWYBRRVQFCI-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C2=C(N=C3C1C=CC=C3)C=CC=C2

Synonyms:

• 9-Acridinecarboxylic Acid, Methyl Ester
• Methyl 9-acridinecarboxylate
• Methyl acridine-9-carboxylate

Methyl 9-Acridinecarboxylate

CAS: 5132-81-0

Formula: C₁₅H₁₁NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 237.2533

Ref: IN-DA00DFB4

Methyl acridine-9-carboxylate

CAS: 5132-81-0

Methyl acridine-9-carboxylate

Purity: 98%

Molecular weight: 237.25g/mol

Ref: 54-OR88950

Methyl acridine-9-carboxylate

CAS: 5132-81-0

Purity: 98%

Molecular weight: 237.25799560546875

Ref: 10-F781432