CAS 51325-95-2
:2-[2-Methyl-6-[2-(2,3,6,7-tetrahydro-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran-4-ylidene]propanedinitrile
Description:
2-[2-Methyl-6-[2-(2,3,6,7-tetrahydro-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran-4-ylidene]propanedinitrile, with CAS number 51325-95-2, is a complex organic compound characterized by its unique structural features, including a pyran ring and a benzoquinolizine moiety. This compound typically exhibits properties associated with its functional groups, such as potential reactivity due to the presence of nitrile groups, which can participate in nucleophilic addition reactions. The presence of multiple rings and substituents suggests that it may have interesting electronic properties, possibly making it suitable for applications in organic electronics or as a dye. Additionally, the stereochemistry of the compound may influence its biological activity, making it a candidate for further pharmacological studies. Its solubility and stability would depend on the specific conditions, such as solvent choice and temperature. Overall, this compound represents a fascinating area of study within organic chemistry, particularly in the context of synthetic applications and material science.
Formula:C23H21N3O
InChI:InChI=1S/C23H21N3O/c1-16-10-20(21(14-24)15-25)13-22(27-16)7-6-17-11-18-4-2-8-26-9-3-5-19(12-17)23(18)26/h6-7,10-13H,2-5,8-9H2,1H3
InChI key:InChIKey=ZNJRONVKWRHYBF-UHFFFAOYSA-N
SMILES:C(=CC1=CC(=C(C#N)C#N)C=C(C)O1)C=2C=C3C4=C(C2)CCCN4CCC3
Synonyms:- 1H,5H-Benzo[ij]quinolizine, propanedinitrile deriv.
- 2-[2-Methyl-6-[2-(2,3,6,7-tetrahydro-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran-4-ylidene]propanedinitrile
- 4-(Dicyanomethylene)-2-methyl-6-(julolidin-9-yl-vinyl)-4H-pyran
- 4-(Dicyanomethylene)-2-methyl-6-julolidyl-9-enyl-4H-pyran
- DCJ
- DCM 2 (dye)
- Dcm 2
- Dcm 684
- Dcm Ii
- Dcm2
- Dcm2/Dcj
- Lt-E702
- Propanedinitrile, 2-[2-methyl-6-[2-(2,3,6,7-tetrahydro-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran-4-ylidene]-
- Propanedinitrile, [2-methyl-6-[2-(2,3,6,7-tetrahydro-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran-4-ylidene]-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(Dicyanomethylene)-2-methyl-6-(julolidin-9-yl-vinyl)-4H-pyran
CAS:Controlled ProductApplications 4-(Dicyanomethylene)-2-methyl-6-(julolidin-4-yl-vinyl)-4H-pyran (CAS# 51325-95-2) is a useful research chemical compound.
Formula:C23H21N3OColor and Shape:NeatMolecular weight:355.432
