CAS 51335-89-8

1-[5-(4-bromophenyl)thiophen-2-yl]ethanone

Description:

1-[5-(4-bromophenyl)thiophen-2-yl]ethanone, with the CAS number 51335-89-8, is an organic compound characterized by its unique structure that includes a thiophene ring and a bromophenyl substituent. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The thiophene moiety imparts aromatic characteristics, contributing to the compound's stability and potential for electronic applications. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its solubility and reactivity can vary depending on the solvent and conditions used, which is important for practical applications in laboratory settings. Overall, this compound represents a versatile building block in the synthesis of more complex organic molecules.

Formula: C₁₂H₉BrOS

InChI: InChI=1/C12H9BrOS/c1-8(14)11-6-7-12(15-11)9-2-4-10(13)5-3-9/h2-7H,1H3

SMILES: CC(=O)c1ccc(c2ccc(cc2)Br)s1

Synonyms:

• 1-[5-(4-Bromophenyl)Thien-2-Yl]Ethanone

1-[5-(4-Bromophenyl)thiophen-2-yl]ethan-1-one

CAS: 51335-89-8

Versatile small molecule scaffold

Formula: C₁₂H₉BrOS

Purity: Min. 95%

Molecular weight: 281.17 g/mol

Ref: 3D-BCA33589