CAS 51336-38-0

ethyl (5-formyl-2-methoxyphenoxy)acetate

Description:

Ethyl (5-formyl-2-methoxyphenoxy)acetate, with the CAS number 51336-38-0, is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol and a carboxylic acid. This compound features a phenoxy group, indicating the presence of a phenolic structure bonded to an ether oxygen, along with a formyl group that contributes to its reactivity and potential applications in organic synthesis. The methoxy group enhances its solubility in organic solvents and may influence its electronic properties. Ethyl (5-formyl-2-methoxyphenoxy)acetate is likely to exhibit moderate volatility and may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, due to the presence of the aldehyde functionality. Its structural characteristics suggest potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₁₄O₅

InChI: InChI=1/C12H14O5/c1-3-16-12(14)8-17-11-6-9(7-13)4-5-10(11)15-2/h4-7H,3,8H2,1-2H3

SMILES: CCOC(=O)COc1cc(ccc1OC)C=O

Ethyl 2-(5-formyl-2-methoxyphenoxy)acetate

CAS: 51336-38-0

Formula: C₁₂H₁₄O₅

Molecular weight: 238.2366

Ref: IN-DA006X9W

Ethyl 2-(3-formyl-6-methoxyphenoxy)acetate

CAS: 51336-38-0

Formula: C₁₂H₁₄O₅

Purity: 95.0%

Molecular weight: 238.239

Ref: 10-F315561

ethyl 2-(5-formyl-2-methoxyphenoxy)acetate

CAS: 51336-38-0

Versatile small molecule scaffold

Formula: C₁₂H₁₄O₅

Purity: Min. 95%

Molecular weight: 238.24 g/mol

Ref: 3D-BCA33638