CAS 51338-33-1
:thiotetronic acid
Description:
Thiotetronic acid is a sulfur-containing heterocyclic compound characterized by its unique structure, which includes a five-membered ring containing both sulfur and oxygen atoms. It is classified as a thiolactone, which is a cyclic ester derived from a thiol and a carboxylic acid. The presence of the sulfur atom in its structure imparts distinct chemical properties, such as increased reactivity towards nucleophiles and the ability to participate in various chemical reactions, including oxidation and reduction processes. Thiotetronic acid is known for its biological activity, particularly as an antibiotic, and has been studied for its potential therapeutic applications. Its solubility in polar solvents and stability under certain conditions make it a subject of interest in both organic synthesis and medicinal chemistry. Additionally, the compound's CAS number, 51338-33-1, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in various scientific fields.
Formula:C4H4O2S
InChI:InChI=1/C4H4O2S/c5-3-1-4(6)7-2-3/h1-2H2
Synonyms:- thiophene-2,4(3H,5H)-dione
- 2,4(3H,5H)-Thiophenedione
- THIOTETRONIC ACID)
- THIOTETRONIC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
