
CAS 5135-80-8
:2-Chloroacetaldehyde 2-(2,4-dinitrophenyl)hydrazone
Description:
2-Chloroacetaldehyde 2-(2,4-dinitrophenyl)hydrazone is an organic compound characterized by its hydrazone functional group, formed from the reaction of 2-chloroacetaldehyde and 2,4-dinitrophenylhydrazine. This compound typically appears as a crystalline solid and is known for its bright yellow color, which is a characteristic feature of many dinitrophenylhydrazones. It is soluble in organic solvents such as ethanol and acetone but may have limited solubility in water. The presence of the chloroacetaldehyde moiety contributes to its reactivity, making it useful in various chemical syntheses and analytical applications. The compound is often employed in the identification and characterization of carbonyl compounds due to its ability to form stable hydrazones. Additionally, it may exhibit biological activity, although specific biological properties would depend on the context of its use. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C8H7ClN4O4
InChI:InChI=1S/C8H7ClN4O4/c9-3-4-10-11-7-2-1-6(12(14)15)5-8(7)13(16)17/h1-2,4-5,11H,3H2
InChI key:InChIKey=KCCZBPFTPLCZGI-UHFFFAOYSA-N
SMILES:N(N=CCCl)C1=C(N(=O)=O)C=C(N(=O)=O)C=C1
Synonyms:- 2-Chloroacetaldehyde 2-(2,4-dinitrophenyl)hydrazone
- OM 1763
- Acetaldehyde, chloro-, (2,4-dinitrophenyl)hydrazone
- Olin 1763
- Acetaldehyde, 2-chloro-, 2-(2,4-dinitrophenyl)hydrazone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
CHLOROACETALDEHYDE (2,4-DINITROPHENYL)HYDRAZONE
CAS:Formula:C8H7ClN4O4Purity:98%Molecular weight:258.6186Chloroacetaldehyde (2,4-dinitrophenyl)hydrazone
CAS:<p>Chloroacetaldehyde (2,4-dinitrophenyl)hydrazone is an anticancer compound that has been shown to exhibit inhibitory effects on tumor growth in Chinese hamsters. This compound is a potent inhibitor of kinases, which are enzymes involved in the regulation of protein activity and cell signaling pathways. Chloroacetaldehyde (2,4-dinitrophenyl)hydrazone analogs have also been shown to induce apoptosis in cancer cells by disrupting mitochondrial function and increasing oxidative stress. In addition to its antitumor properties, this compound has been used as a biomarker for testosterone metabolism in human urine samples. Chloroacetaldehyde (2,4-dinitrophenyl)hydrazone holds promise as a potential therapeutic agent for the treatment of cancer and other diseases associated with abnormal kinase activity.</p>Formula:C8H7ClN4O4Purity:Min. 95%Molecular weight:258.62 g/mol

