CAS 51350-61-9
:12-[(1-Oxooctadecyl)oxy]octadecanoic acid
Description:
12-[(1-Oxooctadecyl)oxy]octadecanoic acid, also known by its CAS number 51350-61-9, is a long-chain fatty acid derivative characterized by a hydrophobic hydrocarbon tail and a polar carboxylic acid functional group. This compound features an ester linkage formed between an octadecanoic acid (stearic acid) and an octadecanoyl group, which contributes to its amphiphilic nature. The presence of the oxo group introduces a carbonyl functionality, enhancing its reactivity and potential applications in various chemical processes. Typically, such compounds exhibit surfactant properties, making them useful in emulsification, solubilization, and as intermediates in the synthesis of more complex molecules. Additionally, the long hydrocarbon chains can influence the compound's physical properties, such as melting point and solubility, which are critical for applications in pharmaceuticals, cosmetics, and materials science. Overall, 12-[(1-Oxooctadecyl)oxy]octadecanoic acid represents a versatile chemical with potential utility in diverse industrial and research settings.
Formula:C36H70O4
InChI:InChI=1S/C36H70O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-22-25-29-33-36(39)40-34(30-26-8-6-4-2)31-27-23-20-18-19-21-24-28-32-35(37)38/h34H,3-33H2,1-2H3,(H,37,38)
InChI key:InChIKey=HCUIHIKPUYHKSQ-UHFFFAOYSA-N
SMILES:C(OC(CCCCCCCCCCCCCCCCC)=O)(CCCCCCCCCCC(O)=O)CCCCCC
Synonyms:- Octadecanoic acid, 12-[(1-oxooctadecyl)oxy]-
- 11-Carboxy-1-hexylundecyl stearate
- 12-SAHSA
- 12-[(1-Oxooctadecyl)oxy]octadecanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
12-SAHSA
CAS:12-SAHSA is a metabolite of the amino acid methionine. It is involved in the regulation of insulin sensitivity and fatty acid metabolism. 12-SAHSA has been shown to decrease hepatic steatosis and inhibit the growth of cancer cells in vitro. 12-SAHSA is formed by oxidation of the hydroxy group in methionine, which can be analyzed using gas chromatography-mass spectrometry (GC-MS). This metabolite can be detected in human serum, tissues, and adipose tissue. The physiological function of 12-SAHSA is not yet clear, but it may play a role in fatty acid metabolism or as an intermediate in the production of other metabolites.Formula:C36H70O4Purity:Min. 95%Molecular weight:566.9 g/mol12-SAHSA
CAS:Branched fatty acid esters of hydroxy fatty acids (FAHFAs) are lipids recently discovered to be modulated by dietary influences such as fasting and high-fat feeding, and they play a role in enhancing insulin sensitivity. These compounds typically feature a carbon-16 or carbon-18 fatty acid (e.g., palmitoleic, palmitic, oleic, or stearic acid) esterified to a carbon-16 or carbon-18 hydroxy fatty acid. A specific example is 12-SAHSA, which consists of stearic acid linked to 12-hydroxy stearic acid. Notably, 12-SAHSA levels are found to be moderately increased in the serum of glucose tolerant AG4OX mice, a model characterized by adipose tissue-specific overexpression of the Glut4 glucose transporter.Formula:C36H70O4Color and Shape:SolidMolecular weight:566.952



