CAS 51355-94-3

6-bromopyridazin-3(2H)-one

Description:

6-Bromopyridazin-3(2H)-one is a heterocyclic organic compound characterized by a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of a bromine atom at the 6-position and a carbonyl group at the 3-position contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in polar organic solvents. It exhibits potential biological activity, making it of interest in medicinal chemistry and pharmaceutical research. The bromine substituent can influence the compound's reactivity and interaction with biological targets. Additionally, 6-bromopyridazin-3(2H)-one may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the electrophilic nature of the carbonyl group. Its structural features allow for the exploration of derivatives that could enhance its pharmacological properties. Overall, this compound serves as a valuable scaffold in the development of new therapeutic agents.

Formula: C₄H₃BrN₂O

InChI: InChI=1/C4H3BrN2O/c5-3-1-2-4(8)7-6-3/h1-2H,(H,7,8)

SMILES: c1cc(nnc1Br)O

6-Bromo-3-pyridazinol

CAS: 51355-94-3

Formula: C₄H₃BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.9834

Ref: IN-DA00DCNL

6-Bromo-3-pyridazinol

CAS: 51355-94-3

6-Bromo-3-pyridazinol

Formula: C₄H₃BrN₂O

Purity: 98%

Color and Shape: off-white powder

Molecular weight: 174.98g/mol

Ref: 54-OR943012

6-bromo-3-pyridazinol

CAS: 51355-94-3

Formula: C₄H₃BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.985

Ref: 10-F312098