CAS 5136-16-3
:5-acetyl-4-(4-methoxyphenyl)-6-methyl-3,4-dihydropyrimidin-2(1H)-one
Description:
5-acetyl-4-(4-methoxyphenyl)-6-methyl-3,4-dihydropyrimidin-2(1H)-one, with the CAS number 5136-16-3, is a heterocyclic organic compound belonging to the dihydropyrimidinone class. This compound features a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. Its structure includes an acetyl group and a methoxyphenyl substituent, contributing to its potential biological activity. The presence of the methoxy group enhances lipophilicity, which may influence its pharmacokinetic properties. This compound has garnered interest in medicinal chemistry due to its potential applications in drug development, particularly as a scaffold for the synthesis of various bioactive molecules. It may exhibit properties such as anti-inflammatory, antimicrobial, or anticancer activities, although specific biological activities would require empirical investigation. The compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in organic synthesis and pharmaceutical applications.
Formula:C14H16N2O3
InChI:InChI=1/C14H16N2O3/c1-8-12(9(2)17)13(16-14(18)15-8)10-4-6-11(19-3)7-5-10/h4-7,13H,1-3H3,(H2,15,16,18)
SMILES:CC1=C(C(=O)C)C(c2ccc(cc2)OC)NC(=N1)O
Synonyms:- 2(1H)-Pyrimidinone, 5-acetyl-3,4-dihydro-4-(4-methoxyphenyl)-6-methyl-
- Ethanone, 1-[1,6-Dihydro-2-Hydroxy-6-(4-Methoxyphenyl)-4-Methyl-5-Pyrimidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-[(6-Aminohexyl)amino]-6-oxo-hexanoic Acid
CAS:Applications 6-[(6-Aminohexyl)amino]-6-oxo-hexanoic acid is a nylon oligomer with flame retardant properties.
References Zahn, Helmut et al.: Chemische Berichte, 92, 1381 (1959)Formula:C12H24N2O3Color and Shape:NeatMolecular weight:244.33

