CAS 51362-30-2
:3-(pyridin-2-yloxy)benzoic acid
Description:
3-(Pyridin-2-yloxy)benzoic acid, with the CAS number 51362-30-2, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a pyridine ring. This compound features a pyridin-2-yloxy group attached to the 3-position of the benzoic acid, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. The presence of both the carboxylic acid and the pyridine functional groups allows for potential hydrogen bonding and interactions with various biological targets, making it of interest in medicinal chemistry and drug development. Additionally, its structure may impart specific reactivity patterns, such as electrophilic substitution or nucleophilic attack, depending on the reaction conditions. Overall, 3-(pyridin-2-yloxy)benzoic acid serves as a versatile compound in research and applications related to pharmaceuticals and agrochemicals.
Formula:C12H9NO3
InChI:InChI=1/C12H9NO3/c14-12(15)9-4-3-5-10(8-9)16-11-6-1-2-7-13-11/h1-8H,(H,14,15)
SMILES:c1ccnc(c1)Oc1cccc(c1)C(=O)O
Synonyms:- 3-(Pyrid-2-Yloxy)Benzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(Pyridin-2-yloxy)benzoic acid
CAS:<p>3-(Pyridin-2-yloxy)benzoic acid is an organic compound that belongs to the group of anilides. It has been shown to be toxic to plants by inhibiting their chlorophyll production and by causing phytotoxicity. 3-(Pyridin-2-yloxy)benzoic acid also inhibits the germination of seeds, primarily due to its inhibition of growth hormone activity. 3-(Pyridin-2-yloxy)benzoic acid can be used as a herbicide because it is highly effective against broadleaf plants, but not grasses. This compound is also relatively non-toxic to mammals and birds, but can cause skin irritation in humans.</p>Formula:C12H9NO3Purity:Min. 95%Molecular weight:215.2 g/mol
